Weak acid is an acid that incompletely dissociated in aqueous solution. Acetic acid is an example of a weak acid
Weak base is a base that only partially dissociates into ions in solution. Weak bases are weak electrolytes. Ammonia is an example of a weak base
Saturated fatty acid is a fatty acid carrying the maximum possible number of hydrogen atoms (It doesn’t have any double bounds in the alkyl chain). The most important of these are:
| Butyric (butanoic acid) | CH3(CH2)2COOH |
| Lauric (dodecanoic acid) | CH3(CH2)10COOH |
| Myristic (tetradecanoic acid) | CH3(CH2)12COOH |
| Palmitic (hexadecanoic acid) | CH3(CH2)14COOH |
| Stearic (octadecanoic acid) | CH3(CH2)16COOH |
| Arachidic (eicosanoic acid) | CH3(CH2)18COOH |
Unsaturated fatty acid is a fatty acid whose carbon chain can absorb additional hydrogen atoms. Their carbon chain has one or more double or triple valence bond per molecule. The most important of these are:
| Oleic (9-octadecenoic acid) | CH3(CH2)7CH=CH(CH2)7COOH |
| Linoleic (9,12-octadecadienoic acid) | CH3(CHCH2)3(CH2CH=CH)2(CHCH2)7COOH |
| Linolenic (9,12,15-octadecatrienoic acid) | CH3(CH2CH=CH)3(CHCH2)7COOH |
Gilbert Newton Lewis (1875-1946) is an American chemist whose theory of the electron pair fostered understanding of the covalent bond and extended the concept of acids and bases.
Amino acids are compounds containing both a carboxylic acid group (-COOH) and an amino group (-NH2 ). The most important are the α-amino acids, in which the -NH2 group in attached to the C atom adjacent to the -COOH group. In the β-amino acids, there is an intervening carbon atom.
Basic Bessemer process is the process of steelmaking in a way that steel, melted iron and limestone are put in the blast-furnace after which the metal oxygen is released in gushes in order to oxidise the impurities.
Carboxylic acids are organic compounds characterized by the presence of one or more RC(=O)OH groups (the carboxyl group). In the systematic chemical nomenclature carboxylic acids names end in the suffix -oic (e.g. ethanoic acids, CH3COOH). The carbon of the terminal group being counted as part of the chain. They are generally weak acids. Carboxylic acids include a large and important class of fatty acids and may be either saturated or unsaturated. There are also some natural aromatic carboxylic acids (benzoic, salicylic).
Generalic, Eni. "Bronsted-Lowry’s acid - base theory." Croatian-English Chemistry Dictionary & Glossary. 29 June 2022. KTF-Split. {Date of access}. <https://glossary.periodni.com>.
Glossary
Periodic Table
