Ionic bond is a strong force of attraction holding atoms together in a molecule or crystal. Typically chemical bonds have energies of about 100 kJ mol-1. Ionic bond is a bond at which one of the participants, during the procedure of bonding, gives away its unpaired electrons to another atom so that both can achieve electron arrangement of the closest noble gas. In order to form an ionic bond one of the atoms must cross to the positively charged ion by losing certain number of electrons and the other atom must receive those electrons and cross to the negatively charged ion.
Peptide bond emerges when two amino acid join in a way that the carbon atom from one connects with the nitrogen atom from the other (creating a C-N bond).
Most single bonds are sigma bonds (σ-bond). In the valence bond theory, a sigma bond is a valence bond that is symmetrical around the imaginary line between the bonded atoms.
Valence bond theory is a theory that explains the shapes of molecules in terms of overlaps between half-filled atomic orbitals, or half filled hybridised orbitals.
Addition reactions are normally occur with unsaturated compounds and involve the addition of one molecule (called the reactant) across the unsaturated bond (i.e. the double bond or the triple bond) of another molecule (called the substrate) to give a single product, formed by the combination of both reacting molecules.
For example, bromine adds across the double bond of ethene in an addition reaction to form dibromoethane.
Alkynes (acetylenes) are acyclic branched or unbranched hydrocarbons having one or more triple carbon-carbon bond. In the systematic chemical nomenclature alkyne names end in the suffix -yne. The general formula is CnH(2n+2)-4x were x is the number of triple bonds. Alkynes that have only one triple bond form a homologous series: ethyne (acetylene), CH≡CH, propyne, CH3CH≡CH, etc. Like alkenes, alkynes undergo addition reaction.
Unsaturated hydrocarbons are organic compounds containing double (alkenes) or triple (alkynes) bonds in their molecules.
Unsaturated fatty acid is a fatty acid whose carbon chain can absorb additional hydrogen atoms. Their carbon chain has one or more double or triple valence bond per molecule. The most important of these are:
| Oleic (9-octadecenoic acid) | CH3(CH2)7CH=CH(CH2)7COOH |
| Linoleic (9,12-octadecadienoic acid) | CH3(CHCH2)3(CH2CH=CH)2(CHCH2)7COOH |
| Linolenic (9,12,15-octadecatrienoic acid) | CH3(CH2CH=CH)3(CHCH2)7COOH |
Generalic, Eni. "Trostruka veza." Croatian-English Chemistry Dictionary & Glossary. 29 June 2022. KTF-Split. {Date of access}. <https://glossary.periodni.com>.
Glossary
Periodic Table
